| Cat. No. | Packing | Purity | Stock | Price | Quantity |
|---|---|---|---|---|---|
| ARTK18091 | Inquiry | 97.00% |
Inquiry
|
|
| CAS No.: | 2832230-22-3 |
| Molecular Formula: | C26H27CLFNO5S |
| Molecular Weight: | 520.00 |
| SMILES: | S(C1C=CC(C)=CC=1)(O)(=O)=O.C[C@@]1(C2C=CC(Cl)=CC=2F)OC2=CC=CC(C3CCNCC3)=C2O1 |
| English Name: | Piperidine, 4-[(2R)-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-, compd. with 4-methy |
| English Alias: | Piperidine, 4-[(2R)-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-, compd. with 4-methy;2832230-22-3;4-[(2R)-2-(4-chloro-2-fluoro-phenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidine 4-methylbenzenesulfonic acid;F78111;PS-16015;SCHEMBL25286845;(R)-4-(2-(4-CHLORO-2-FLUOROPHENYL)-2-METHYLBENZO[D][1,3]DIOXOL-4-YL)PIPERIDINE 4-METHYLBENZENESULFONATE;4-[(2R)-2-(4-chloro-2-fluoro-phenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidine;4-methylbenzenesulfonic acid |
| Pictogram | |
| Warning words | |
| Class | |
| Warning statement | |
| UNub | |
| Hazard statement | |
| Packing Group |